C36H29F5O5S2 — CID 142692518
2-[1-[[4-(4-tert-butylphenyl)phenyl]-phenylsulfonio]naphthalene-2-carbonyl]oxy-1,1,3,3,3-pentafluoropropane-1-sulfonate (PubChem CID 142692518) has the molecular formula C36H29F5O5S2 and a molecular weight of 700.75 g/mol. Its IUPAC name is 2-[1-[[4-(4-tert-butylphenyl)phenyl]-phenylsulfonio]naphthalene-2-carbonyl]oxy-1,1,3,3,3-pentafluoropropane-1-sulfonate.
| Compound Name | 2-[1-[[4-(4-tert-butylphenyl)phenyl]-phenylsulfonio]naphthalene-2-carbonyl]oxy-1,1,3,3,3-pentafluoropropane-1-sulfonate |
|---|---|
| PubChem CID | 142692518 |
| Molecular Formula | C36H29F5O5S2 |
| Molecular Weight | 700.75 g/mol |
| Exact Mass | 700.14 |
| IUPAC Name | 2-[1-[[4-(4-tert-butylphenyl)phenyl]-phenylsulfonio]naphthalene-2-carbonyl]oxy-1,1,3,3,3-pentafluoropropane-1-sulfonate |
| SMILES | CC(C)(C)c1ccc(-c2ccc([S+](c3ccccc3)c3c(C(=O)OC(C(F)(F)F)C(F)(F)S(=O)(=O)[O-])ccc4ccccc34)cc2)cc1 |
| InChI | InChI=1S/C36H29F5O5S2/c1-34(2,3)26-18-13-23(14-19-26)24-15-20-28(21-16-24)47(27-10-5-4-6-11-27)31-29-12-8-7-9-25(29)17-22-30(31)32(42)46-33(35(37,38)39)36(40,41)48(43,44)45/h4-22,33H,1-3H3 |
| InChIKey | CNXANZGCMKUIRL-UHFFFAOYSA-N |
| XLogP | 9.13 |
| TPSA | 83.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.75 |
| LogP ≤ 5 | 9.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|