About 2-methylsulfinyl-6,8-dihydro-5H-pyrimido[4,5-d]pyrimidin-7-one
2-methylsulfinyl-6,8-dihydro-5H-pyrimido[4,5-d]pyrimidin-7-one (PubChem CID 142692527) has the molecular formula C7H8N4O2S
and a molecular weight of 212.23 g/mol. Its IUPAC name is 2-methylsulfinyl-6,8-dihydro-5H-pyrimido[4,5-d]pyrimidin-7-one.
Molecular Properties
| Compound Name | 2-methylsulfinyl-6,8-dihydro-5H-pyrimido[4,5-d]pyrimidin-7-one |
| PubChem CID | 142692527 |
| Molecular Formula | C7H8N4O2S |
| Molecular Weight | 212.23 g/mol |
| Exact Mass | 212.04 |
| IUPAC Name | 2-methylsulfinyl-6,8-dihydro-5H-pyrimido[4,5-d]pyrimidin-7-one |
| SMILES | CS(=O)c1ncc2c(n1)NC(=O)NC2 |
| InChI | InChI=1S/C7H8N4O2S/c1-14(13)7-9-3-4-2-8-6(12)10-5(4)11-7/h3H,2H2,1H3,(H2,8,9,10,11,12) |
| InChIKey | QGMQDCADEGZXKW-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.23 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-methylsulfinyl-6,8-dihydro-5H-pyrimido[4,5-d]pyrimidin-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylsulfinyl-6,8-dihydro-5H-pyrimido[4,5-d]pyrimidin-7-one?
The IUPAC name of 2-methylsulfinyl-6,8-dihydro-5H-pyrimido[4,5-d]pyrimidin-7-one (CID 142692527) is 2-methylsulfinyl-6,8-dihydro-5H-pyrimido[4,5-d]pyrimidin-7-one.
What is the SMILES notation for 2-methylsulfinyl-6,8-dihydro-5H-pyrimido[4,5-d]pyrimidin-7-one?
The canonical SMILES for 2-methylsulfinyl-6,8-dihydro-5H-pyrimido[4,5-d]pyrimidin-7-one is CS(=O)c1ncc2c(n1)NC(=O)NC2.
What is the InChIKey of 2-methylsulfinyl-6,8-dihydro-5H-pyrimido[4,5-d]pyrimidin-7-one?
The InChIKey is QGMQDCADEGZXKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N4O2S/c1-14(13)7-9-3-4-2-8-6(12)10-5(4)11-7/h3H,2H2,1H3,(H2,8,9,10,11,12).
What are the key properties of 2-methylsulfinyl-6,8-dihydro-5H-pyrimido[4,5-d]pyrimidin-7-one?
2-methylsulfinyl-6,8-dihydro-5H-pyrimido[4,5-d]pyrimidin-7-one has a molecular weight of 212.23 g/mol, XLogP of -0.15, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylsulfinyl-6,8-dihydro-5H-pyrimido[4,5-d]pyrimidin-7-one is sourced from PubChem (CID 142692527), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).