C24H29N3O5S — CID 142692670
tert-butyl 4-[4-[1-benzofuran-2-ylsulfonyl(methyl)amino]phenyl]piperazine-1-carboxylate (PubChem CID 142692670) has the molecular formula C24H29N3O5S and a molecular weight of 471.58 g/mol. Its IUPAC name is tert-butyl 4-[4-[1-benzofuran-2-ylsulfonyl(methyl)amino]phenyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-[1-benzofuran-2-ylsulfonyl(methyl)amino]phenyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 142692670 |
| Molecular Formula | C24H29N3O5S |
| Molecular Weight | 471.58 g/mol |
| Exact Mass | 471.18 |
| IUPAC Name | tert-butyl 4-[4-[1-benzofuran-2-ylsulfonyl(methyl)amino]phenyl]piperazine-1-carboxylate |
| SMILES | CN(c1ccc(N2CCN(C(=O)OC(C)(C)C)CC2)cc1)S(=O)(=O)c1cc2ccccc2o1 |
| InChI | InChI=1S/C24H29N3O5S/c1-24(2,3)32-23(28)27-15-13-26(14-16-27)20-11-9-19(10-12-20)25(4)33(29,30)22-17-18-7-5-6-8-21(18)31-22/h5-12,17H,13-16H2,1-4H3 |
| InChIKey | DTGFWQIFAHNFHN-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 83.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.58 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|