About 2-[4-(3,5-difluorophenyl)-1,3-thiazol-2-yl]guanidine;hydrochloride
2-[4-(3,5-difluorophenyl)-1,3-thiazol-2-yl]guanidine;hydrochloride (PubChem CID 142693097) has the molecular formula C10H9ClF2N4S
and a molecular weight of 290.73 g/mol. Its IUPAC name is 2-[4-(3,5-difluorophenyl)-1,3-thiazol-2-yl]guanidine;hydrochloride.
Molecular Properties
| Compound Name | 2-[4-(3,5-difluorophenyl)-1,3-thiazol-2-yl]guanidine;hydrochloride |
| PubChem CID | 142693097 |
| Molecular Formula | C10H9ClF2N4S |
| Molecular Weight | 290.73 g/mol |
| Exact Mass | 290.02 |
| IUPAC Name | 2-[4-(3,5-difluorophenyl)-1,3-thiazol-2-yl]guanidine;hydrochloride |
| SMILES | Cl.NC(N)=Nc1nc(-c2cc(F)cc(F)c2)cs1 |
| InChI | InChI=1S/C10H8F2N4S.ClH/c11-6-1-5(2-7(12)3-6)8-4-17-10(15-8)16-9(13)14;/h1-4H,(H4,13,14,15,16);1H |
| InChIKey | BNJKKMKEYVIKFX-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 77.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.73 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-(3,5-difluorophenyl)-1,3-thiazol-2-yl]guanidine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(3,5-difluorophenyl)-1,3-thiazol-2-yl]guanidine;hydrochloride?
The IUPAC name of 2-[4-(3,5-difluorophenyl)-1,3-thiazol-2-yl]guanidine;hydrochloride (CID 142693097) is 2-[4-(3,5-difluorophenyl)-1,3-thiazol-2-yl]guanidine;hydrochloride.
What is the SMILES notation for 2-[4-(3,5-difluorophenyl)-1,3-thiazol-2-yl]guanidine;hydrochloride?
The canonical SMILES for 2-[4-(3,5-difluorophenyl)-1,3-thiazol-2-yl]guanidine;hydrochloride is Cl.NC(N)=Nc1nc(-c2cc(F)cc(F)c2)cs1.
What is the InChIKey of 2-[4-(3,5-difluorophenyl)-1,3-thiazol-2-yl]guanidine;hydrochloride?
The InChIKey is BNJKKMKEYVIKFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8F2N4S.ClH/c11-6-1-5(2-7(12)3-6)8-4-17-10(15-8)16-9(13)14;/h1-4H,(H4,13,14,15,16);1H.
What are the key properties of 2-[4-(3,5-difluorophenyl)-1,3-thiazol-2-yl]guanidine;hydrochloride?
2-[4-(3,5-difluorophenyl)-1,3-thiazol-2-yl]guanidine;hydrochloride has a molecular weight of 290.73 g/mol, XLogP of 2.41, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(3,5-difluorophenyl)-1,3-thiazol-2-yl]guanidine;hydrochloride is sourced from PubChem (CID 142693097), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).