C18H14F3N3O3 — CID 142693144
[2-[5-[(1S)-1-amino-2-phenylethyl]-1,2,4-oxadiazol-3-yl]phenyl] 2,2,2-trifluoroacetate (PubChem CID 142693144) has the molecular formula C18H14F3N3O3 and a molecular weight of 377.32 g/mol. Its IUPAC name is [2-[5-[(1S)-1-amino-2-phenylethyl]-1,2,4-oxadiazol-3-yl]phenyl] 2,2,2-trifluoroacetate.
| Compound Name | [2-[5-[(1S)-1-amino-2-phenylethyl]-1,2,4-oxadiazol-3-yl]phenyl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 142693144 |
| Molecular Formula | C18H14F3N3O3 |
| Molecular Weight | 377.32 g/mol |
| Exact Mass | 377.10 |
| IUPAC Name | [2-[5-[(1S)-1-amino-2-phenylethyl]-1,2,4-oxadiazol-3-yl]phenyl] 2,2,2-trifluoroacetate |
| SMILES | N[C@@H](Cc1ccccc1)c1nc(-c2ccccc2OC(=O)C(F)(F)F)no1 |
| InChI | InChI=1S/C18H14F3N3O3/c19-18(20,21)17(25)26-14-9-5-4-8-12(14)15-23-16(27-24-15)13(22)10-11-6-2-1-3-7-11/h1-9,13H,10,22H2/t13-/m0/s1 |
| InChIKey | TZEVGFWYLWGGAG-ZDUSSCGKSA-N |
| XLogP | 3.45 |
| TPSA | 91.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.32 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|