C24H15BrF10N2O2S — CID 142693261
3-[N-benzoyl-2-[bromo-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-(trifluoromethyl)-λ4-sulfanyl]anilino]benzamide (PubChem CID 142693261) has the molecular formula C24H15BrF10N2O2S and a molecular weight of 665.35 g/mol. Its IUPAC name is 3-[N-benzoyl-2-[bromo-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-(trifluoromethyl)-λ4-sulfanyl]anilino]benzamide.
| Compound Name | 3-[N-benzoyl-2-[bromo-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-(trifluoromethyl)-λ4-sulfanyl]anilino]benzamide |
|---|---|
| PubChem CID | 142693261 |
| Molecular Formula | C24H15BrF10N2O2S |
| Molecular Weight | 665.35 g/mol |
| Exact Mass | 663.99 |
| IUPAC Name | 3-[N-benzoyl-2-[bromo-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-(trifluoromethyl)-λ4-sulfanyl]anilino]benzamide |
| SMILES | NC(=O)c1cccc(N(C(=O)c2ccccc2)c2ccccc2S(Br)(C(F)(F)F)C(F)(C(F)(F)F)C(F)(F)F)c1 |
| InChI | InChI=1S/C24H15BrF10N2O2S/c25-40(24(33,34)35,21(26,22(27,28)29)23(30,31)32)18-12-5-4-11-17(18)37(20(39)14-7-2-1-3-8-14)16-10-6-9-15(13-16)19(36)38/h1-13H,(H2,36,38) |
| InChIKey | UDIPVNDGIJSDHJ-UHFFFAOYSA-N |
| XLogP | 8.55 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.35 |
| LogP ≤ 5 | 8.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |