C15H14N2O2 — CID 142695128
1-[1-[(5-methyl-1,2-oxazol-3-yl)methyl]indol-3-yl]ethanone (PubChem CID 142695128) has the molecular formula C15H14N2O2 and a molecular weight of 254.29 g/mol. Its IUPAC name is 1-[1-[(5-methyl-1,2-oxazol-3-yl)methyl]indol-3-yl]ethanone.
| Compound Name | 1-[1-[(5-methyl-1,2-oxazol-3-yl)methyl]indol-3-yl]ethanone |
|---|---|
| PubChem CID | 142695128 |
| Molecular Formula | C15H14N2O2 |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.11 |
| IUPAC Name | 1-[1-[(5-methyl-1,2-oxazol-3-yl)methyl]indol-3-yl]ethanone |
| SMILES | CC(=O)c1cn(Cc2cc(C)on2)c2ccccc12 |
| InChI | InChI=1S/C15H14N2O2/c1-10-7-12(16-19-10)8-17-9-14(11(2)18)13-5-3-4-6-15(13)17/h3-7,9H,8H2,1-2H3 |
| InChIKey | LBCGHBULZRQQEO-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 48.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |