About 2-hydroxy-1,2-dihydropyridine-3-carboxamide
2-hydroxy-1,2-dihydropyridine-3-carboxamide (PubChem CID 142695333) has the molecular formula C6H8N2O2
and a molecular weight of 140.14 g/mol. Its IUPAC name is 2-hydroxy-1,2-dihydropyridine-3-carboxamide.
Molecular Properties
| Compound Name | 2-hydroxy-1,2-dihydropyridine-3-carboxamide |
| PubChem CID | 142695333 |
| Molecular Formula | C6H8N2O2 |
| Molecular Weight | 140.14 g/mol |
| Exact Mass | 140.06 |
| IUPAC Name | 2-hydroxy-1,2-dihydropyridine-3-carboxamide |
| SMILES | NC(=O)C1=CC=CNC1O |
| InChI | InChI=1S/C6H8N2O2/c7-5(9)4-2-1-3-8-6(4)10/h1-3,6,8,10H,(H2,7,9) |
| InChIKey | BLHZRIVHJHZOBH-UHFFFAOYSA-N |
| XLogP | -1.17 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.14 |
| LogP ≤ 5 | -1.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-hydroxy-1,2-dihydropyridine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxy-1,2-dihydropyridine-3-carboxamide?
The IUPAC name of 2-hydroxy-1,2-dihydropyridine-3-carboxamide (CID 142695333) is 2-hydroxy-1,2-dihydropyridine-3-carboxamide.
What is the SMILES notation for 2-hydroxy-1,2-dihydropyridine-3-carboxamide?
The canonical SMILES for 2-hydroxy-1,2-dihydropyridine-3-carboxamide is NC(=O)C1=CC=CNC1O.
What is the InChIKey of 2-hydroxy-1,2-dihydropyridine-3-carboxamide?
The InChIKey is BLHZRIVHJHZOBH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N2O2/c7-5(9)4-2-1-3-8-6(4)10/h1-3,6,8,10H,(H2,7,9).
What are the key properties of 2-hydroxy-1,2-dihydropyridine-3-carboxamide?
2-hydroxy-1,2-dihydropyridine-3-carboxamide has a molecular weight of 140.14 g/mol, XLogP of -1.17, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxy-1,2-dihydropyridine-3-carboxamide is sourced from PubChem (CID 142695333), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).