C13H14F12O4S — CID 142695530
methyl 5,5,6,6,7,7,7-heptafluoro-2-(4,4,5,5,5-pentafluoropentan-2-ylsulfonyl)heptanoate (PubChem CID 142695530) has the molecular formula C13H14F12O4S and a molecular weight of 494.29 g/mol. Its IUPAC name is methyl 5,5,6,6,7,7,7-heptafluoro-2-(4,4,5,5,5-pentafluoropentan-2-ylsulfonyl)heptanoate.
| Compound Name | methyl 5,5,6,6,7,7,7-heptafluoro-2-(4,4,5,5,5-pentafluoropentan-2-ylsulfonyl)heptanoate |
|---|---|
| PubChem CID | 142695530 |
| Molecular Formula | C13H14F12O4S |
| Molecular Weight | 494.29 g/mol |
| Exact Mass | 494.04 |
| IUPAC Name | methyl 5,5,6,6,7,7,7-heptafluoro-2-(4,4,5,5,5-pentafluoropentan-2-ylsulfonyl)heptanoate |
| SMILES | COC(=O)C(CCC(F)(F)C(F)(F)C(F)(F)F)S(=O)(=O)C(C)CC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C13H14F12O4S/c1-6(5-10(16,17)12(20,21)22)30(27,28)7(8(26)29-2)3-4-9(14,15)11(18,19)13(23,24)25/h6-7H,3-5H2,1-2H3 |
| InChIKey | VMCMPVHIPFVDOX-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.29 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|