C7H4F3NO4 — CID 142695988
2,3,4-trifluoro-4-nitrocyclohexa-1,5-diene-1-carboxylic acid (PubChem CID 142695988) has the molecular formula C7H4F3NO4 and a molecular weight of 223.11 g/mol. Its IUPAC name is 2,3,4-trifluoro-4-nitrocyclohexa-1,5-diene-1-carboxylic acid.
| Compound Name | 2,3,4-trifluoro-4-nitrocyclohexa-1,5-diene-1-carboxylic acid |
|---|---|
| PubChem CID | 142695988 |
| Molecular Formula | C7H4F3NO4 |
| Molecular Weight | 223.11 g/mol |
| Exact Mass | 223.01 |
| IUPAC Name | 2,3,4-trifluoro-4-nitrocyclohexa-1,5-diene-1-carboxylic acid |
| SMILES | O=C(O)C1=C(F)C(F)C(F)([N+](=O)[O-])C=C1 |
| InChI | InChI=1S/C7H4F3NO4/c8-4-3(6(12)13)1-2-7(10,5(4)9)11(14)15/h1-2,5H,(H,12,13) |
| InChIKey | XZWKECTXQLDNOA-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 80.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.11 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|