About 4'-phenylspiro[3H-1,3-benzothiazole-2,1'-cyclohexane]
4'-phenylspiro[3H-1,3-benzothiazole-2,1'-cyclohexane] (PubChem CID 14269660) has the molecular formula C18H19NS
and a molecular weight of 281.42 g/mol. Its IUPAC name is 4'-phenylspiro[3H-1,3-benzothiazole-2,1'-cyclohexane].
Molecular Properties
| Compound Name | 4'-phenylspiro[3H-1,3-benzothiazole-2,1'-cyclohexane] |
| PubChem CID | 14269660 |
| Molecular Formula | C18H19NS |
| Molecular Weight | 281.42 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | 4'-phenylspiro[3H-1,3-benzothiazole-2,1'-cyclohexane] |
| SMILES | c1ccc(C2CCC3(CC2)Nc2ccccc2S3)cc1 |
| InChI | InChI=1S/C18H19NS/c1-2-6-14(7-3-1)15-10-12-18(13-11-15)19-16-8-4-5-9-17(16)20-18/h1-9,15,19H,10-13H2 |
| InChIKey | PRHSHSBELQVCKN-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 281.42 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4'-phenylspiro[3H-1,3-benzothiazole-2,1'-cyclohexane] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4'-phenylspiro[3H-1,3-benzothiazole-2,1'-cyclohexane]?
The IUPAC name of 4'-phenylspiro[3H-1,3-benzothiazole-2,1'-cyclohexane] (CID 14269660) is 4'-phenylspiro[3H-1,3-benzothiazole-2,1'-cyclohexane].
What is the SMILES notation for 4'-phenylspiro[3H-1,3-benzothiazole-2,1'-cyclohexane]?
The canonical SMILES for 4'-phenylspiro[3H-1,3-benzothiazole-2,1'-cyclohexane] is c1ccc(C2CCC3(CC2)Nc2ccccc2S3)cc1.
What is the InChIKey of 4'-phenylspiro[3H-1,3-benzothiazole-2,1'-cyclohexane]?
The InChIKey is PRHSHSBELQVCKN-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19NS/c1-2-6-14(7-3-1)15-10-12-18(13-11-15)19-16-8-4-5-9-17(16)20-18/h1-9,15,19H,10-13H2.
What are the key properties of 4'-phenylspiro[3H-1,3-benzothiazole-2,1'-cyclohexane]?
4'-phenylspiro[3H-1,3-benzothiazole-2,1'-cyclohexane] has a molecular weight of 281.42 g/mol, XLogP of 5.26, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4'-phenylspiro[3H-1,3-benzothiazole-2,1'-cyclohexane] is sourced from PubChem (CID 14269660), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).