About cinnolin-5-yl formate
cinnolin-5-yl formate (PubChem CID 142696685) has the molecular formula C9H6N2O2
and a molecular weight of 174.16 g/mol. Its IUPAC name is cinnolin-5-yl formate.
Molecular Properties
| Compound Name | cinnolin-5-yl formate |
| PubChem CID | 142696685 |
| Molecular Formula | C9H6N2O2 |
| Molecular Weight | 174.16 g/mol |
| Exact Mass | 174.04 |
| IUPAC Name | cinnolin-5-yl formate |
| SMILES | O=COc1cccc2nnccc12 |
| InChI | InChI=1S/C9H6N2O2/c12-6-13-9-3-1-2-8-7(9)4-5-10-11-8/h1-6H |
| InChIKey | YSZVHNKSJSZOEX-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.16 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze cinnolin-5-yl formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cinnolin-5-yl formate?
The IUPAC name of cinnolin-5-yl formate (CID 142696685) is cinnolin-5-yl formate.
What is the SMILES notation for cinnolin-5-yl formate?
The canonical SMILES for cinnolin-5-yl formate is O=COc1cccc2nnccc12.
What is the InChIKey of cinnolin-5-yl formate?
The InChIKey is YSZVHNKSJSZOEX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6N2O2/c12-6-13-9-3-1-2-8-7(9)4-5-10-11-8/h1-6H.
What are the key properties of cinnolin-5-yl formate?
cinnolin-5-yl formate has a molecular weight of 174.16 g/mol, XLogP of 1.16, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for cinnolin-5-yl formate is sourced from PubChem (CID 142696685), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).