C41H36O2 — CID 142697053
1,3-bis[4-(2,4,6-trimethylphenyl)naphthalen-1-yl]propane-1,3-dione (PubChem CID 142697053) has the molecular formula C41H36O2 and a molecular weight of 560.74 g/mol. Its IUPAC name is 1,3-bis[4-(2,4,6-trimethylphenyl)naphthalen-1-yl]propane-1,3-dione.
| Compound Name | 1,3-bis[4-(2,4,6-trimethylphenyl)naphthalen-1-yl]propane-1,3-dione |
|---|---|
| PubChem CID | 142697053 |
| Molecular Formula | C41H36O2 |
| Molecular Weight | 560.74 g/mol |
| Exact Mass | 560.27 |
| IUPAC Name | 1,3-bis[4-(2,4,6-trimethylphenyl)naphthalen-1-yl]propane-1,3-dione |
| SMILES | Cc1cc(C)c(-c2ccc(C(=O)CC(=O)c3ccc(-c4c(C)cc(C)cc4C)c4ccccc34)c3ccccc23)c(C)c1 |
| InChI | InChI=1S/C41H36O2/c1-24-19-26(3)40(27(4)20-24)36-17-15-34(30-11-7-9-13-32(30)36)38(42)23-39(43)35-16-18-37(33-14-10-8-12-31(33)35)41-28(5)21-25(2)22-29(41)6/h7-22H,23H2,1-6H3 |
| InChIKey | CTJASFKXHJHGFO-UHFFFAOYSA-N |
| XLogP | 10.63 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.74 |
| LogP ≤ 5 | 10.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|