C24H34N2O6S — CID 142697711
7-cyclohexyl-3,4,5-trihydroxy-2-methoxy-N-[(3R)-5-methyl-4-oxo-2,3-dihydro-1,5-benzothiazepin-3-yl]hept-6-enamide (PubChem CID 142697711) has the molecular formula C24H34N2O6S and a molecular weight of 478.61 g/mol. Its IUPAC name is 7-cyclohexyl-3,4,5-trihydroxy-2-methoxy-N-[(3R)-5-methyl-4-oxo-2,3-dihydro-1,5-benzothiazepin-3-yl]hept-6-enamide.
| Compound Name | 7-cyclohexyl-3,4,5-trihydroxy-2-methoxy-N-[(3R)-5-methyl-4-oxo-2,3-dihydro-1,5-benzothiazepin-3-yl]hept-6-enamide |
|---|---|
| PubChem CID | 142697711 |
| Molecular Formula | C24H34N2O6S |
| Molecular Weight | 478.61 g/mol |
| Exact Mass | 478.21 |
| IUPAC Name | 7-cyclohexyl-3,4,5-trihydroxy-2-methoxy-N-[(3R)-5-methyl-4-oxo-2,3-dihydro-1,5-benzothiazepin-3-yl]hept-6-enamide |
| SMILES | COC(C(=O)N[C@H]1CSc2ccccc2N(C)C1=O)C(O)C(O)C(O)C=CC1CCCCC1 |
| InChI | InChI=1S/C24H34N2O6S/c1-26-17-10-6-7-11-19(17)33-14-16(24(26)31)25-23(30)22(32-2)21(29)20(28)18(27)13-12-15-8-4-3-5-9-15/h6-7,10-13,15-16,18,20-22,27-29H,3-5,8-9,14H2,1-2H3,(H,25,30)/t16-,18?,20?,21?,22?/m0/s1 |
| InChIKey | RLYRYNGUPODLBA-BNCHWQNESA-N |
| XLogP | 1.47 |
| TPSA | 119.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.61 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|