C11H10O7 — CID 142698225
3,4,7-trihydroxy-10-methyl-3,4-dihydro-1,6-benzodioxocine-2,5-dione (PubChem CID 142698225) has the molecular formula C11H10O7 and a molecular weight of 254.19 g/mol. Its IUPAC name is 3,4,7-trihydroxy-10-methyl-3,4-dihydro-1,6-benzodioxocine-2,5-dione.
| Compound Name | 3,4,7-trihydroxy-10-methyl-3,4-dihydro-1,6-benzodioxocine-2,5-dione |
|---|---|
| PubChem CID | 142698225 |
| Molecular Formula | C11H10O7 |
| Molecular Weight | 254.19 g/mol |
| Exact Mass | 254.04 |
| IUPAC Name | 3,4,7-trihydroxy-10-methyl-3,4-dihydro-1,6-benzodioxocine-2,5-dione |
| SMILES | Cc1ccc(O)c2c1OC(=O)C(O)C(O)C(=O)O2 |
| InChI | InChI=1S/C11H10O7/c1-4-2-3-5(12)9-8(4)17-10(15)6(13)7(14)11(16)18-9/h2-3,6-7,12-14H,1H3 |
| InChIKey | QOAZXIFYBICWQM-UHFFFAOYSA-N |
| XLogP | -0.75 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.19 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|