About 2-bromo-1,1-dimethoxy-3-methylbutane
2-bromo-1,1-dimethoxy-3-methylbutane (PubChem CID 14269828) has the molecular formula C7H15BrO2
and a molecular weight of 211.10 g/mol. Its IUPAC name is 2-bromo-1,1-dimethoxy-3-methylbutane.
Molecular Properties
| Compound Name | 2-bromo-1,1-dimethoxy-3-methylbutane |
| PubChem CID | 14269828 |
| Molecular Formula | C7H15BrO2 |
| Molecular Weight | 211.10 g/mol |
| Exact Mass | 210.03 |
| IUPAC Name | 2-bromo-1,1-dimethoxy-3-methylbutane |
| SMILES | COC(OC)C(Br)C(C)C |
| InChI | InChI=1S/C7H15BrO2/c1-5(2)6(8)7(9-3)10-4/h5-7H,1-4H3 |
| InChIKey | ZQLMTSUVYBWVEX-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.10 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-1,1-dimethoxy-3-methylbutane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-1,1-dimethoxy-3-methylbutane?
The IUPAC name of 2-bromo-1,1-dimethoxy-3-methylbutane (CID 14269828) is 2-bromo-1,1-dimethoxy-3-methylbutane.
What is the SMILES notation for 2-bromo-1,1-dimethoxy-3-methylbutane?
The canonical SMILES for 2-bromo-1,1-dimethoxy-3-methylbutane is COC(OC)C(Br)C(C)C.
What is the InChIKey of 2-bromo-1,1-dimethoxy-3-methylbutane?
The InChIKey is ZQLMTSUVYBWVEX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15BrO2/c1-5(2)6(8)7(9-3)10-4/h5-7H,1-4H3.
What are the key properties of 2-bromo-1,1-dimethoxy-3-methylbutane?
2-bromo-1,1-dimethoxy-3-methylbutane has a molecular weight of 211.10 g/mol, XLogP of 2.02, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-1,1-dimethoxy-3-methylbutane is sourced from PubChem (CID 14269828), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).