C25H18N6O5 — CID 142699429
3-methoxy-N-[5-(3-nitrophenyl)-7-oxo-3-phenyl-1H-pyrazolo[4,3-d]pyrimidin-6-yl]benzamide (PubChem CID 142699429) has the molecular formula C25H18N6O5 and a molecular weight of 482.46 g/mol. Its IUPAC name is 3-methoxy-N-[5-(3-nitrophenyl)-7-oxo-3-phenyl-1H-pyrazolo[4,3-d]pyrimidin-6-yl]benzamide.
| Compound Name | 3-methoxy-N-[5-(3-nitrophenyl)-7-oxo-3-phenyl-1H-pyrazolo[4,3-d]pyrimidin-6-yl]benzamide |
|---|---|
| PubChem CID | 142699429 |
| Molecular Formula | C25H18N6O5 |
| Molecular Weight | 482.46 g/mol |
| Exact Mass | 482.13 |
| IUPAC Name | 3-methoxy-N-[5-(3-nitrophenyl)-7-oxo-3-phenyl-1H-pyrazolo[4,3-d]pyrimidin-6-yl]benzamide |
| SMILES | COc1cccc(C(=O)Nn2c(-c3cccc([N+](=O)[O-])c3)nc3c(-c4ccccc4)n[nH]c3c2=O)c1 |
| InChI | InChI=1S/C25H18N6O5/c1-36-19-12-6-10-17(14-19)24(32)29-30-23(16-9-5-11-18(13-16)31(34)35)26-21-20(15-7-3-2-4-8-15)27-28-22(21)25(30)33/h2-14H,1H3,(H,27,28)(H,29,32) |
| InChIKey | PSCDTCXZILORFD-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 145.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.46 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|