About 5-chloro-2,4-dimethoxypyrimidine
5-chloro-2,4-dimethoxypyrimidine (PubChem CID 14270028) has the molecular formula C6H7ClN2O2
and a molecular weight of 174.59 g/mol. Its IUPAC name is 5-chloro-2,4-dimethoxypyrimidine.
Molecular Properties
| Compound Name | 5-chloro-2,4-dimethoxypyrimidine |
| PubChem CID | 14270028 |
| Molecular Formula | C6H7ClN2O2 |
| Molecular Weight | 174.59 g/mol |
| Exact Mass | 174.02 |
| IUPAC Name | 5-chloro-2,4-dimethoxypyrimidine |
| SMILES | COc1ncc(Cl)c(OC)n1 |
| InChI | InChI=1S/C6H7ClN2O2/c1-10-5-4(7)3-8-6(9-5)11-2/h3H,1-2H3 |
| InChIKey | NEAICPKWHCRGIM-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.59 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-chloro-2,4-dimethoxypyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-2,4-dimethoxypyrimidine?
The IUPAC name of 5-chloro-2,4-dimethoxypyrimidine (CID 14270028) is 5-chloro-2,4-dimethoxypyrimidine.
What is the SMILES notation for 5-chloro-2,4-dimethoxypyrimidine?
The canonical SMILES for 5-chloro-2,4-dimethoxypyrimidine is COc1ncc(Cl)c(OC)n1.
What is the InChIKey of 5-chloro-2,4-dimethoxypyrimidine?
The InChIKey is NEAICPKWHCRGIM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7ClN2O2/c1-10-5-4(7)3-8-6(9-5)11-2/h3H,1-2H3.
What are the key properties of 5-chloro-2,4-dimethoxypyrimidine?
5-chloro-2,4-dimethoxypyrimidine has a molecular weight of 174.59 g/mol, XLogP of 1.15, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-2,4-dimethoxypyrimidine is sourced from PubChem (CID 14270028), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).