C21H36O2S — CID 142700306
2-sulfanylpropyl (9E,12E,15E)-octadeca-9,12,15-trienoate (PubChem CID 142700306) has the molecular formula C21H36O2S and a molecular weight of 352.58 g/mol. Its IUPAC name is 2-sulfanylpropyl (9E,12E,15E)-octadeca-9,12,15-trienoate.
| Compound Name | 2-sulfanylpropyl (9E,12E,15E)-octadeca-9,12,15-trienoate |
|---|---|
| PubChem CID | 142700306 |
| Molecular Formula | C21H36O2S |
| Molecular Weight | 352.58 g/mol |
| Exact Mass | 352.24 |
| IUPAC Name | 2-sulfanylpropyl (9E,12E,15E)-octadeca-9,12,15-trienoate |
| SMILES | CC/C=C/C/C=C/C/C=C/CCCCCCCC(=O)OCC(C)S |
| InChI | InChI=1S/C21H36O2S/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-21(22)23-19-20(2)24/h4-5,7-8,10-11,20,24H,3,6,9,12-19H2,1-2H3/b5-4+,8-7+,11-10+ |
| InChIKey | YBNKGPLDPLJCSC-JSIPCRQOSA-N |
| XLogP | 6.44 |
| TPSA | 26.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.58 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|