C19H26O — CID 142700718
(2R,3S,5S)-3-ethynyl-5-pentyl-2-(2-phenylethyl)oxolane (PubChem CID 142700718) has the molecular formula C19H26O and a molecular weight of 270.42 g/mol. Its IUPAC name is (2R,3S,5S)-3-ethynyl-5-pentyl-2-(2-phenylethyl)oxolane.
| Compound Name | (2R,3S,5S)-3-ethynyl-5-pentyl-2-(2-phenylethyl)oxolane |
|---|---|
| PubChem CID | 142700718 |
| Molecular Formula | C19H26O |
| Molecular Weight | 270.42 g/mol |
| Exact Mass | 270.20 |
| IUPAC Name | (2R,3S,5S)-3-ethynyl-5-pentyl-2-(2-phenylethyl)oxolane |
| SMILES | C#C[C@@H]1C[C@H](CCCCC)O[C@@H]1CCc1ccccc1 |
| InChI | InChI=1S/C19H26O/c1-3-5-7-12-18-15-17(4-2)19(20-18)14-13-16-10-8-6-9-11-16/h2,6,8-11,17-19H,3,5,7,12-15H2,1H3/t17-,18+,19-/m1/s1 |
| InChIKey | QDLVMQGCTKZQLZ-CEXWTWQISA-N |
| XLogP | 4.61 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.42 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|