C31H57NO3S — CID 142701067
2-(9-octylheptadecan-9-ylazaniumyl)benzenesulfonate (PubChem CID 142701067) has the molecular formula C31H57NO3S and a molecular weight of 523.87 g/mol. Its IUPAC name is 2-(9-octylheptadecan-9-ylazaniumyl)benzenesulfonate.
| Compound Name | 2-(9-octylheptadecan-9-ylazaniumyl)benzenesulfonate |
|---|---|
| PubChem CID | 142701067 |
| Molecular Formula | C31H57NO3S |
| Molecular Weight | 523.87 g/mol |
| Exact Mass | 523.41 |
| IUPAC Name | 2-(9-octylheptadecan-9-ylazaniumyl)benzenesulfonate |
| SMILES | CCCCCCCCC(CCCCCCCC)(CCCCCCCC)[NH2+]c1ccccc1S(=O)(=O)[O-] |
| InChI | InChI=1S/C31H57NO3S/c1-4-7-10-13-16-21-26-31(27-22-17-14-11-8-5-2,28-23-18-15-12-9-6-3)32-29-24-19-20-25-30(29)36(33,34)35/h19-20,24-25,32H,4-18,21-23,26-28H2,1-3H3,(H,33,34,35) |
| InChIKey | IOHDQLAPNASIOD-UHFFFAOYSA-N |
| XLogP | 8.78 |
| TPSA | 73.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.87 |
| LogP ≤ 5 | 8.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|