C7H7NO4 — CID 142701304
(3R,4R)-3,4-dihydroxy-1-prop-2-ynylpyrrolidine-2,5-dione (PubChem CID 142701304) has the molecular formula C7H7NO4 and a molecular weight of 169.14 g/mol. Its IUPAC name is (3R,4R)-3,4-dihydroxy-1-prop-2-ynylpyrrolidine-2,5-dione.
| Compound Name | (3R,4R)-3,4-dihydroxy-1-prop-2-ynylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 142701304 |
| Molecular Formula | C7H7NO4 |
| Molecular Weight | 169.14 g/mol |
| Exact Mass | 169.04 |
| IUPAC Name | (3R,4R)-3,4-dihydroxy-1-prop-2-ynylpyrrolidine-2,5-dione |
| SMILES | C#CCN1C(=O)[C@H](O)[C@@H](O)C1=O |
| InChI | InChI=1S/C7H7NO4/c1-2-3-8-6(11)4(9)5(10)7(8)12/h1,4-5,9-10H,3H2/t4-,5-/m1/s1 |
| InChIKey | PJTXBTHCUBINOO-RFZPGFLSSA-N |
| XLogP | -2.29 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.14 |
| LogP ≤ 5 | -2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|