C54H39N3 — CID 142701393
1,3,4,5,7,8-hexakis-phenyltriphenylene-2,6,11-triamine (PubChem CID 142701393) has the molecular formula C54H39N3 and a molecular weight of 729.93 g/mol. Its IUPAC name is 1,3,4,5,7,8-hexakis-phenyltriphenylene-2,6,11-triamine.
| Compound Name | 1,3,4,5,7,8-hexakis-phenyltriphenylene-2,6,11-triamine |
|---|---|
| PubChem CID | 142701393 |
| Molecular Formula | C54H39N3 |
| Molecular Weight | 729.93 g/mol |
| Exact Mass | 729.31 |
| IUPAC Name | 1,3,4,5,7,8-hexakis-phenyltriphenylene-2,6,11-triamine |
| SMILES | Nc1ccc2c(c1)c1c(-c3ccccc3)c(N)c(-c3ccccc3)c(-c3ccccc3)c1c1c(-c3ccccc3)c(N)c(-c3ccccc3)c(-c3ccccc3)c21 |
| InChI | InChI=1S/C54H39N3/c55-40-31-32-41-42(33-40)50-47(38-27-15-5-16-28-38)53(56)46(37-25-13-4-14-26-37)44(35-21-9-2-10-22-35)51(50)52-48(39-29-17-6-18-30-39)54(57)45(36-23-11-3-12-24-36)43(49(41)52)34-19-7-1-8-20-34/h1-33H,55-57H2 |
| InChIKey | UDVFIPDYBNSEJX-UHFFFAOYSA-N |
| XLogP | 13.89 |
| TPSA | 78.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 729.93 |
| LogP ≤ 5 | 13.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|