About 6-methyl-3,3-bis[4-methyl-2-(propylamino)phenyl]-4-(propylamino)-2-benzofuran-1-one
6-methyl-3,3-bis[4-methyl-2-(propylamino)phenyl]-4-(propylamino)-2-benzofuran-1-one (PubChem CID 142701487) has the molecular formula C32H41N3O2
and a molecular weight of 499.70 g/mol. Its IUPAC name is 6-methyl-3,3-bis[4-methyl-2-(propylamino)phenyl]-4-(propylamino)-2-benzofuran-1-one.
Molecular Properties
| Compound Name | 6-methyl-3,3-bis[4-methyl-2-(propylamino)phenyl]-4-(propylamino)-2-benzofuran-1-one |
| PubChem CID | 142701487 |
| Molecular Formula | C32H41N3O2 |
| Molecular Weight | 499.70 g/mol |
| Exact Mass | 499.32 |
| IUPAC Name | 6-methyl-3,3-bis[4-methyl-2-(propylamino)phenyl]-4-(propylamino)-2-benzofuran-1-one |
| SMILES | CCCNc1cc(C)ccc1C1(c2ccc(C)cc2NCCC)OC(=O)c2cc(C)cc(NCCC)c21 |
| InChI | InChI=1S/C32H41N3O2/c1-7-14-33-27-18-21(4)10-12-25(27)32(26-13-11-22(5)19-28(26)34-15-8-2)30-24(31(36)37-32)17-23(6)20-29(30)35-16-9-3/h10-13,17-20,33-35H,7-9,14-16H2,1-6H3 |
| InChIKey | OIBDCUPWXLFZPQ-UHFFFAOYSA-N |
| XLogP | 7.54 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 499.70 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-methyl-3,3-bis[4-methyl-2-(propylamino)phenyl]-4-(propylamino)-2-benzofuran-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-3,3-bis[4-methyl-2-(propylamino)phenyl]-4-(propylamino)-2-benzofuran-1-one?
The IUPAC name of 6-methyl-3,3-bis[4-methyl-2-(propylamino)phenyl]-4-(propylamino)-2-benzofuran-1-one (CID 142701487) is 6-methyl-3,3-bis[4-methyl-2-(propylamino)phenyl]-4-(propylamino)-2-benzofuran-1-one.
What is the SMILES notation for 6-methyl-3,3-bis[4-methyl-2-(propylamino)phenyl]-4-(propylamino)-2-benzofuran-1-one?
The canonical SMILES for 6-methyl-3,3-bis[4-methyl-2-(propylamino)phenyl]-4-(propylamino)-2-benzofuran-1-one is CCCNc1cc(C)ccc1C1(c2ccc(C)cc2NCCC)OC(=O)c2cc(C)cc(NCCC)c21.
What is the InChIKey of 6-methyl-3,3-bis[4-methyl-2-(propylamino)phenyl]-4-(propylamino)-2-benzofuran-1-one?
The InChIKey is OIBDCUPWXLFZPQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C32H41N3O2/c1-7-14-33-27-18-21(4)10-12-25(27)32(26-13-11-22(5)19-28(26)34-15-8-2)30-24(31(36)37-32)17-23(6)20-29(30)35-16-9-3/h10-13,17-20,33-35H,7-9,14-16H2,1-6H3.
What are the key properties of 6-methyl-3,3-bis[4-methyl-2-(propylamino)phenyl]-4-(propylamino)-2-benzofuran-1-one?
6-methyl-3,3-bis[4-methyl-2-(propylamino)phenyl]-4-(propylamino)-2-benzofuran-1-one has a molecular weight of 499.70 g/mol, XLogP of 7.54, 11 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-3,3-bis[4-methyl-2-(propylamino)phenyl]-4-(propylamino)-2-benzofuran-1-one is sourced from PubChem (CID 142701487), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).