C24H25N3O2 — CID 142701489
4-amino-3,3-bis[4-(dimethylamino)phenyl]-2-benzofuran-1-one (PubChem CID 142701489) has the molecular formula C24H25N3O2 and a molecular weight of 387.48 g/mol. Its IUPAC name is 4-amino-3,3-bis[4-(dimethylamino)phenyl]-2-benzofuran-1-one.
| Compound Name | 4-amino-3,3-bis[4-(dimethylamino)phenyl]-2-benzofuran-1-one |
|---|---|
| PubChem CID | 142701489 |
| Molecular Formula | C24H25N3O2 |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.19 |
| IUPAC Name | 4-amino-3,3-bis[4-(dimethylamino)phenyl]-2-benzofuran-1-one |
| SMILES | CN(C)c1ccc(C2(c3ccc(N(C)C)cc3)OC(=O)c3cccc(N)c32)cc1 |
| InChI | InChI=1S/C24H25N3O2/c1-26(2)18-12-8-16(9-13-18)24(17-10-14-19(15-11-17)27(3)4)22-20(23(28)29-24)6-5-7-21(22)25/h5-15H,25H2,1-4H3 |
| InChIKey | XZXDLHKJXNXLOX-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 58.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|