C17H20F4O — CID 142701801
1-[[(1R,3R)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropyl]methyl]-2,3,5,6-tetrafluoro-4-methoxybenzene (PubChem CID 142701801) has the molecular formula C17H20F4O and a molecular weight of 316.34 g/mol. Its IUPAC name is 1-[[(1R,3R)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropyl]methyl]-2,3,5,6-tetrafluoro-4-methoxybenzene.
| Compound Name | 1-[[(1R,3R)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropyl]methyl]-2,3,5,6-tetrafluoro-4-methoxybenzene |
|---|---|
| PubChem CID | 142701801 |
| Molecular Formula | C17H20F4O |
| Molecular Weight | 316.34 g/mol |
| Exact Mass | 316.15 |
| IUPAC Name | 1-[[(1R,3R)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropyl]methyl]-2,3,5,6-tetrafluoro-4-methoxybenzene |
| SMILES | COc1c(F)c(F)c(C[C@@H]2[C@@H](C=C(C)C)C2(C)C)c(F)c1F |
| InChI | InChI=1S/C17H20F4O/c1-8(2)6-10-11(17(10,3)4)7-9-12(18)14(20)16(22-5)15(21)13(9)19/h6,10-11H,7H2,1-5H3/t10-,11-/m1/s1 |
| InChIKey | UMSKYILYCNHMTP-GHMZBOCLSA-N |
| XLogP | 5.03 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.34 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|