C29H35BrN6O4 — CID 142702551
tert-butyl 2-(6-bromo-1-butoxycarbonylindazol-3-yl)-4-(4-methylpiperazin-1-yl)benzimidazole-1-carboxylate (PubChem CID 142702551) has the molecular formula C29H35BrN6O4 and a molecular weight of 611.54 g/mol. Its IUPAC name is tert-butyl 2-(6-bromo-1-butoxycarbonylindazol-3-yl)-4-(4-methylpiperazin-1-yl)benzimidazole-1-carboxylate.
| Compound Name | tert-butyl 2-(6-bromo-1-butoxycarbonylindazol-3-yl)-4-(4-methylpiperazin-1-yl)benzimidazole-1-carboxylate |
|---|---|
| PubChem CID | 142702551 |
| Molecular Formula | C29H35BrN6O4 |
| Molecular Weight | 611.54 g/mol |
| Exact Mass | 610.19 |
| IUPAC Name | tert-butyl 2-(6-bromo-1-butoxycarbonylindazol-3-yl)-4-(4-methylpiperazin-1-yl)benzimidazole-1-carboxylate |
| SMILES | CCCCOC(=O)n1nc(-c2nc3c(N4CCN(C)CC4)cccc3n2C(=O)OC(C)(C)C)c2ccc(Br)cc21 |
| InChI | InChI=1S/C29H35BrN6O4/c1-6-7-17-39-28(38)36-23-18-19(30)11-12-20(23)24(32-36)26-31-25-21(34-15-13-33(5)14-16-34)9-8-10-22(25)35(26)27(37)40-29(2,3)4/h8-12,18H,6-7,13-17H2,1-5H3 |
| InChIKey | PGZNAIPFEIMHOD-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 94.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.54 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|