C17H28O4 — CID 142702684
(3,5-ditert-butyl-4,4-dihydroxycyclohexa-1,5-dien-1-yl) propanoate (PubChem CID 142702684) has the molecular formula C17H28O4 and a molecular weight of 296.41 g/mol. Its IUPAC name is (3,5-ditert-butyl-4,4-dihydroxycyclohexa-1,5-dien-1-yl) propanoate.
| Compound Name | (3,5-ditert-butyl-4,4-dihydroxycyclohexa-1,5-dien-1-yl) propanoate |
|---|---|
| PubChem CID | 142702684 |
| Molecular Formula | C17H28O4 |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.20 |
| IUPAC Name | (3,5-ditert-butyl-4,4-dihydroxycyclohexa-1,5-dien-1-yl) propanoate |
| SMILES | CCC(=O)OC1=CC(C(C)(C)C)C(O)(O)C(C(C)(C)C)=C1 |
| InChI | InChI=1S/C17H28O4/c1-8-14(18)21-11-9-12(15(2,3)4)17(19,20)13(10-11)16(5,6)7/h9-10,12,19-20H,8H2,1-7H3 |
| InChIKey | PTZSKEBVHUGAAV-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|