C17H21Br2NO2 — CID 142703429
N-[2-(1,5-dibromo-6-prop-2-enoxy-2,3-dihydroinden-1-yl)ethyl]propanamide (PubChem CID 142703429) has the molecular formula C17H21Br2NO2 and a molecular weight of 431.17 g/mol. Its IUPAC name is N-[2-(1,5-dibromo-6-prop-2-enoxy-2,3-dihydroinden-1-yl)ethyl]propanamide.
| Compound Name | N-[2-(1,5-dibromo-6-prop-2-enoxy-2,3-dihydroinden-1-yl)ethyl]propanamide |
|---|---|
| PubChem CID | 142703429 |
| Molecular Formula | C17H21Br2NO2 |
| Molecular Weight | 431.17 g/mol |
| Exact Mass | 428.99 |
| IUPAC Name | N-[2-(1,5-dibromo-6-prop-2-enoxy-2,3-dihydroinden-1-yl)ethyl]propanamide |
| SMILES | C=CCOc1cc2c(cc1Br)CCC2(Br)CCNC(=O)CC |
| InChI | InChI=1S/C17H21Br2NO2/c1-3-9-22-15-11-13-12(10-14(15)18)5-6-17(13,19)7-8-20-16(21)4-2/h3,10-11H,1,4-9H2,2H3,(H,20,21) |
| InChIKey | AZHGSLWKUQPKOY-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.17 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|