About 2,6-dibutyl-1,4-dithiine
2,6-dibutyl-1,4-dithiine (PubChem CID 14270398) has the molecular formula C12H20S2
and a molecular weight of 228.43 g/mol. Its IUPAC name is 2,6-dibutyl-1,4-dithiine.
Molecular Properties
| Compound Name | 2,6-dibutyl-1,4-dithiine |
| PubChem CID | 14270398 |
| Molecular Formula | C12H20S2 |
| Molecular Weight | 228.43 g/mol |
| Exact Mass | 228.10 |
| IUPAC Name | 2,6-dibutyl-1,4-dithiine |
| SMILES | CCCCC1=CSC=C(CCCC)S1 |
| InChI | InChI=1S/C12H20S2/c1-3-5-7-11-9-13-10-12(14-11)8-6-4-2/h9-10H,3-8H2,1-2H3 |
| InChIKey | XYJWPLOKFKMHBX-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 228.43 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,6-dibutyl-1,4-dithiine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-dibutyl-1,4-dithiine?
The IUPAC name of 2,6-dibutyl-1,4-dithiine (CID 14270398) is 2,6-dibutyl-1,4-dithiine.
What is the SMILES notation for 2,6-dibutyl-1,4-dithiine?
The canonical SMILES for 2,6-dibutyl-1,4-dithiine is CCCCC1=CSC=C(CCCC)S1.
What is the InChIKey of 2,6-dibutyl-1,4-dithiine?
The InChIKey is XYJWPLOKFKMHBX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20S2/c1-3-5-7-11-9-13-10-12(14-11)8-6-4-2/h9-10H,3-8H2,1-2H3.
What are the key properties of 2,6-dibutyl-1,4-dithiine?
2,6-dibutyl-1,4-dithiine has a molecular weight of 228.43 g/mol, XLogP of 5.53, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-dibutyl-1,4-dithiine is sourced from PubChem (CID 14270398), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).