About 2,3,4,5-tetrapropylthiophene
2,3,4,5-tetrapropylthiophene (PubChem CID 14270410) has the molecular formula C16H28S
and a molecular weight of 252.47 g/mol. Its IUPAC name is 2,3,4,5-tetrapropylthiophene.
Molecular Properties
| Compound Name | 2,3,4,5-tetrapropylthiophene |
| PubChem CID | 14270410 |
| Molecular Formula | C16H28S |
| Molecular Weight | 252.47 g/mol |
| Exact Mass | 252.19 |
| IUPAC Name | 2,3,4,5-tetrapropylthiophene |
| SMILES | CCCc1sc(CCC)c(CCC)c1CCC |
| InChI | InChI=1S/C16H28S/c1-5-9-13-14(10-6-2)16(12-8-4)17-15(13)11-7-3/h5-12H2,1-4H3 |
| InChIKey | RPTZEPYRLAJILD-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 252.47 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,3,4,5-tetrapropylthiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3,4,5-tetrapropylthiophene?
The IUPAC name of 2,3,4,5-tetrapropylthiophene (CID 14270410) is 2,3,4,5-tetrapropylthiophene.
What is the SMILES notation for 2,3,4,5-tetrapropylthiophene?
The canonical SMILES for 2,3,4,5-tetrapropylthiophene is CCCc1sc(CCC)c(CCC)c1CCC.
What is the InChIKey of 2,3,4,5-tetrapropylthiophene?
The InChIKey is RPTZEPYRLAJILD-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H28S/c1-5-9-13-14(10-6-2)16(12-8-4)17-15(13)11-7-3/h5-12H2,1-4H3.
What are the key properties of 2,3,4,5-tetrapropylthiophene?
2,3,4,5-tetrapropylthiophene has a molecular weight of 252.47 g/mol, XLogP of 5.56, 8 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3,4,5-tetrapropylthiophene is sourced from PubChem (CID 14270410), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).