C17H12F3N3O2 — CID 142704193
1-hydroxy-5-[3-phenyl-2-(trifluoromethyl)phenyl]pyrazole-3-carboxamide (PubChem CID 142704193) has the molecular formula C17H12F3N3O2 and a molecular weight of 347.30 g/mol. Its IUPAC name is 1-hydroxy-5-[3-phenyl-2-(trifluoromethyl)phenyl]pyrazole-3-carboxamide.
| Compound Name | 1-hydroxy-5-[3-phenyl-2-(trifluoromethyl)phenyl]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 142704193 |
| Molecular Formula | C17H12F3N3O2 |
| Molecular Weight | 347.30 g/mol |
| Exact Mass | 347.09 |
| IUPAC Name | 1-hydroxy-5-[3-phenyl-2-(trifluoromethyl)phenyl]pyrazole-3-carboxamide |
| SMILES | NC(=O)c1cc(-c2cccc(-c3ccccc3)c2C(F)(F)F)n(O)n1 |
| InChI | InChI=1S/C17H12F3N3O2/c18-17(19,20)15-11(10-5-2-1-3-6-10)7-4-8-12(15)14-9-13(16(21)24)22-23(14)25/h1-9,25H,(H2,21,24) |
| InChIKey | MKKWTWQAHXMFAR-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.30 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|