C11F21N — CID 14270448
2,2,3,3,4,4,5,5,6,6-decafluoro-1-(1,2,2,3,3,4,4,5,5,6,6-undecafluorocyclohexyl)piperidine (PubChem CID 14270448) has the molecular formula C11F21N and a molecular weight of 545.09 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5,6,6-decafluoro-1-(1,2,2,3,3,4,4,5,5,6,6-undecafluorocyclohexyl)piperidine.
| Compound Name | 2,2,3,3,4,4,5,5,6,6-decafluoro-1-(1,2,2,3,3,4,4,5,5,6,6-undecafluorocyclohexyl)piperidine |
|---|---|
| PubChem CID | 14270448 |
| Molecular Formula | C11F21N |
| Molecular Weight | 545.09 g/mol |
| Exact Mass | 544.97 |
| IUPAC Name | 2,2,3,3,4,4,5,5,6,6-decafluoro-1-(1,2,2,3,3,4,4,5,5,6,6-undecafluorocyclohexyl)piperidine |
| SMILES | FC1(F)N(C2(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C2(F)F)C(F)(F)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C11F21N/c12-1(13)2(14,15)5(20,21)9(28,6(22,23)3(1,16)17)33-10(29,30)7(24,25)4(18,19)8(26,27)11(33,31)32 |
| InChIKey | OIRQPKJKSXGLIE-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.09 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|