About CID 14270474
CID 14270474 (PubChem CID 14270474) has the molecular formula C3H9N2
and a molecular weight of 73.12 g/mol.
Molecular Properties
| Compound Name | CID 14270474 |
| PubChem CID | 14270474 |
| Molecular Formula | C3H9N2 |
| Molecular Weight | 73.12 g/mol |
| Exact Mass | 73.08 |
| IUPAC Name | — |
| SMILES | C[N]N(C)C |
| InChI | InChI=1S/C3H9N2/c1-4-5(2)3/h1-3H3 |
| InChIKey | WCURWPVXOUADIW-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 17.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 73.12 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze CID 14270474 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 14270474?
The IUPAC name of CID 14270474 (CID 14270474) is not available.
What is the SMILES notation for CID 14270474?
The canonical SMILES for CID 14270474 is C[N]N(C)C.
What is the InChIKey of CID 14270474?
The InChIKey is WCURWPVXOUADIW-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H9N2/c1-4-5(2)3/h1-3H3.
What are the key properties of CID 14270474?
CID 14270474 has a molecular weight of 73.12 g/mol, XLogP of -0.30, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 14270474 is sourced from PubChem (CID 14270474), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).