About thieno[3,2-d][1]benzoxepine
thieno[3,2-d][1]benzoxepine (PubChem CID 142705820) has the molecular formula C12H8OS
and a molecular weight of 200.26 g/mol. Its IUPAC name is thieno[3,2-d][1]benzoxepine.
Molecular Properties
| Compound Name | thieno[3,2-d][1]benzoxepine |
| PubChem CID | 142705820 |
| Molecular Formula | C12H8OS |
| Molecular Weight | 200.26 g/mol |
| Exact Mass | 200.03 |
| IUPAC Name | thieno[3,2-d][1]benzoxepine |
| SMILES | C1=Cc2ccsc2-c2ccccc2O1 |
| InChI | InChI=1S/C12H8OS/c1-2-4-11-10(3-1)12-9(5-7-13-11)6-8-14-12/h1-8H |
| InChIKey | JNDKORCRIBZVGK-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.26 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze thieno[3,2-d][1]benzoxepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of thieno[3,2-d][1]benzoxepine?
The IUPAC name of thieno[3,2-d][1]benzoxepine (CID 142705820) is thieno[3,2-d][1]benzoxepine.
What is the SMILES notation for thieno[3,2-d][1]benzoxepine?
The canonical SMILES for thieno[3,2-d][1]benzoxepine is C1=Cc2ccsc2-c2ccccc2O1.
What is the InChIKey of thieno[3,2-d][1]benzoxepine?
The InChIKey is JNDKORCRIBZVGK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8OS/c1-2-4-11-10(3-1)12-9(5-7-13-11)6-8-14-12/h1-8H.
What are the key properties of thieno[3,2-d][1]benzoxepine?
thieno[3,2-d][1]benzoxepine has a molecular weight of 200.26 g/mol, XLogP of 3.78, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for thieno[3,2-d][1]benzoxepine is sourced from PubChem (CID 142705820), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).