C28H41FN4O4 — CID 142706636
(2R)-2-(cyclopentylmethyl)-N-[(2S)-1-[(1R)-7-[(4-fluorophenyl)methyl]-3,7-diazabicyclo[4.1.0]heptan-3-yl]-3,3-dimethyl-1-oxobutan-2-yl]-3-[formyl(hydroxy)amino]propanamide (PubChem CID 142706636) has the molecular formula C28H41FN4O4 and a molecular weight of 516.66 g/mol. Its IUPAC name is (2R)-2-(cyclopentylmethyl)-N-[(2S)-1-[(1R)-7-[(4-fluorophenyl)methyl]-3,7-diazabicyclo[4.1.0]heptan-3-yl]-3,3-dimethyl-1-oxobutan-2-yl]-3-[formyl(hydroxy)amino]propanamide.
| Compound Name | (2R)-2-(cyclopentylmethyl)-N-[(2S)-1-[(1R)-7-[(4-fluorophenyl)methyl]-3,7-diazabicyclo[4.1.0]heptan-3-yl]-3,3-dimethyl-1-oxobutan-2-yl]-3-[formyl(hydroxy)amino]propanamide |
|---|---|
| PubChem CID | 142706636 |
| Molecular Formula | C28H41FN4O4 |
| Molecular Weight | 516.66 g/mol |
| Exact Mass | 516.31 |
| IUPAC Name | (2R)-2-(cyclopentylmethyl)-N-[(2S)-1-[(1R)-7-[(4-fluorophenyl)methyl]-3,7-diazabicyclo[4.1.0]heptan-3-yl]-3,3-dimethyl-1-oxobutan-2-yl]-3-[formyl(hydroxy)amino]propanamide |
| SMILES | CC(C)(C)[C@H](NC(=O)[C@H](CC1CCCC1)CN(O)C=O)C(=O)N1CCC2[C@@H](C1)N2Cc1ccc(F)cc1 |
| InChI | InChI=1S/C28H41FN4O4/c1-28(2,3)25(30-26(35)21(16-32(37)18-34)14-19-6-4-5-7-19)27(36)31-13-12-23-24(17-31)33(23)15-20-8-10-22(29)11-9-20/h8-11,18-19,21,23-25,37H,4-7,12-17H2,1-3H3,(H,30,35)/t21-,23?,24-,25-,33?/m1/s1 |
| InChIKey | DGYXKDBLGLZKQE-DLNNRBLESA-N |
| XLogP | 3.19 |
| TPSA | 92.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.66 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|