About 5-sulfanyl-1,3,2-dioxathiepane-4,7-dione
5-sulfanyl-1,3,2-dioxathiepane-4,7-dione (PubChem CID 142706796) has the molecular formula C4H4O4S2
and a molecular weight of 180.21 g/mol. Its IUPAC name is 5-sulfanyl-1,3,2-dioxathiepane-4,7-dione.
Molecular Properties
| Compound Name | 5-sulfanyl-1,3,2-dioxathiepane-4,7-dione |
| PubChem CID | 142706796 |
| Molecular Formula | C4H4O4S2 |
| Molecular Weight | 180.21 g/mol |
| Exact Mass | 179.96 |
| IUPAC Name | 5-sulfanyl-1,3,2-dioxathiepane-4,7-dione |
| SMILES | O=C1CC(S)C(=O)OSO1 |
| InChI | InChI=1S/C4H4O4S2/c5-3-1-2(9)4(6)8-10-7-3/h2,9H,1H2 |
| InChIKey | QLTJZVLRGRAWEZ-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 52.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.21 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 5-sulfanyl-1,3,2-dioxathiepane-4,7-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-sulfanyl-1,3,2-dioxathiepane-4,7-dione?
The IUPAC name of 5-sulfanyl-1,3,2-dioxathiepane-4,7-dione (CID 142706796) is 5-sulfanyl-1,3,2-dioxathiepane-4,7-dione.
What is the SMILES notation for 5-sulfanyl-1,3,2-dioxathiepane-4,7-dione?
The canonical SMILES for 5-sulfanyl-1,3,2-dioxathiepane-4,7-dione is O=C1CC(S)C(=O)OSO1.
What is the InChIKey of 5-sulfanyl-1,3,2-dioxathiepane-4,7-dione?
The InChIKey is QLTJZVLRGRAWEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H4O4S2/c5-3-1-2(9)4(6)8-10-7-3/h2,9H,1H2.
What are the key properties of 5-sulfanyl-1,3,2-dioxathiepane-4,7-dione?
5-sulfanyl-1,3,2-dioxathiepane-4,7-dione has a molecular weight of 180.21 g/mol, XLogP of 0.34, 0 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-sulfanyl-1,3,2-dioxathiepane-4,7-dione is sourced from PubChem (CID 142706796), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).