C24H23FO6S2 — CID 142707158
5,5-bis(benzenesulfonyl)-5-fluoro-4-(4-methoxyphenyl)pentan-2-one (PubChem CID 142707158) has the molecular formula C24H23FO6S2 and a molecular weight of 490.57 g/mol. Its IUPAC name is 5,5-bis(benzenesulfonyl)-5-fluoro-4-(4-methoxyphenyl)pentan-2-one.
| Compound Name | 5,5-bis(benzenesulfonyl)-5-fluoro-4-(4-methoxyphenyl)pentan-2-one |
|---|---|
| PubChem CID | 142707158 |
| Molecular Formula | C24H23FO6S2 |
| Molecular Weight | 490.57 g/mol |
| Exact Mass | 490.09 |
| IUPAC Name | 5,5-bis(benzenesulfonyl)-5-fluoro-4-(4-methoxyphenyl)pentan-2-one |
| SMILES | COc1ccc(C(CC(C)=O)C(F)(S(=O)(=O)c2ccccc2)S(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C24H23FO6S2/c1-18(26)17-23(19-13-15-20(31-2)16-14-19)24(25,32(27,28)21-9-5-3-6-10-21)33(29,30)22-11-7-4-8-12-22/h3-16,23H,17H2,1-2H3 |
| InChIKey | RCBVHRAOKJWNSB-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 94.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.57 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |