C24H23FO5S2 — CID 142707160
6,6-bis(benzenesulfonyl)-6-fluoro-5-phenylhexan-3-one (PubChem CID 142707160) has the molecular formula C24H23FO5S2 and a molecular weight of 474.58 g/mol. Its IUPAC name is 6,6-bis(benzenesulfonyl)-6-fluoro-5-phenylhexan-3-one.
| Compound Name | 6,6-bis(benzenesulfonyl)-6-fluoro-5-phenylhexan-3-one |
|---|---|
| PubChem CID | 142707160 |
| Molecular Formula | C24H23FO5S2 |
| Molecular Weight | 474.58 g/mol |
| Exact Mass | 474.10 |
| IUPAC Name | 6,6-bis(benzenesulfonyl)-6-fluoro-5-phenylhexan-3-one |
| SMILES | CCC(=O)CC(c1ccccc1)C(F)(S(=O)(=O)c1ccccc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C24H23FO5S2/c1-2-20(26)18-23(19-12-6-3-7-13-19)24(25,31(27,28)21-14-8-4-9-15-21)32(29,30)22-16-10-5-11-17-22/h3-17,23H,2,18H2,1H3 |
| InChIKey | YXUGJONGMATORF-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 85.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.58 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |