C9H21N3O4S — CID 142707174
propan-2-yl N-methyl-N-[4-(sulfamoylamino)butyl]carbamate (PubChem CID 142707174) has the molecular formula C9H21N3O4S and a molecular weight of 267.35 g/mol. Its IUPAC name is propan-2-yl N-methyl-N-[4-(sulfamoylamino)butyl]carbamate.
| Compound Name | propan-2-yl N-methyl-N-[4-(sulfamoylamino)butyl]carbamate |
|---|---|
| PubChem CID | 142707174 |
| Molecular Formula | C9H21N3O4S |
| Molecular Weight | 267.35 g/mol |
| Exact Mass | 267.13 |
| IUPAC Name | propan-2-yl N-methyl-N-[4-(sulfamoylamino)butyl]carbamate |
| SMILES | CC(C)OC(=O)N(C)CCCCNS(N)(=O)=O |
| InChI | InChI=1S/C9H21N3O4S/c1-8(2)16-9(13)12(3)7-5-4-6-11-17(10,14)15/h8,11H,4-7H2,1-3H3,(H2,10,14,15) |
| InChIKey | VTFZALVESQLIEU-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.35 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|