C26H38N2O4 — CID 142707528
6-[3-hydroxypropyl(2-naphthalen-1-ylethyl)amino]-N-(oxan-2-yloxy)hexanamide (PubChem CID 142707528) has the molecular formula C26H38N2O4 and a molecular weight of 442.60 g/mol. Its IUPAC name is 6-[3-hydroxypropyl(2-naphthalen-1-ylethyl)amino]-N-(oxan-2-yloxy)hexanamide.
| Compound Name | 6-[3-hydroxypropyl(2-naphthalen-1-ylethyl)amino]-N-(oxan-2-yloxy)hexanamide |
|---|---|
| PubChem CID | 142707528 |
| Molecular Formula | C26H38N2O4 |
| Molecular Weight | 442.60 g/mol |
| Exact Mass | 442.28 |
| IUPAC Name | 6-[3-hydroxypropyl(2-naphthalen-1-ylethyl)amino]-N-(oxan-2-yloxy)hexanamide |
| SMILES | O=C(CCCCCN(CCCO)CCc1cccc2ccccc12)NOC1CCCCO1 |
| InChI | InChI=1S/C26H38N2O4/c29-20-9-18-28(19-16-23-12-8-11-22-10-3-4-13-24(22)23)17-6-1-2-14-25(30)27-32-26-15-5-7-21-31-26/h3-4,8,10-13,26,29H,1-2,5-7,9,14-21H2,(H,27,30) |
| InChIKey | FGKXZXJZUIPTSN-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.60 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|