About 1-nitrosoazecan-2-one
1-nitrosoazecan-2-one (PubChem CID 14270809) has the molecular formula C9H16N2O2
and a molecular weight of 184.24 g/mol. Its IUPAC name is 1-nitrosoazecan-2-one.
Molecular Properties
| Compound Name | 1-nitrosoazecan-2-one |
| PubChem CID | 14270809 |
| Molecular Formula | C9H16N2O2 |
| Molecular Weight | 184.24 g/mol |
| Exact Mass | 184.12 |
| IUPAC Name | 1-nitrosoazecan-2-one |
| SMILES | O=NN1CCCCCCCCC1=O |
| InChI | InChI=1S/C9H16N2O2/c12-9-7-5-3-1-2-4-6-8-11(9)10-13/h1-8H2 |
| InChIKey | SGGMFBOXDGBEQY-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 49.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.24 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-nitroso', 'substructure': 'N/A'} |
|---|
Analyze 1-nitrosoazecan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-nitrosoazecan-2-one?
The IUPAC name of 1-nitrosoazecan-2-one (CID 14270809) is 1-nitrosoazecan-2-one.
What is the SMILES notation for 1-nitrosoazecan-2-one?
The canonical SMILES for 1-nitrosoazecan-2-one is O=NN1CCCCCCCCC1=O.
What is the InChIKey of 1-nitrosoazecan-2-one?
The InChIKey is SGGMFBOXDGBEQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N2O2/c12-9-7-5-3-1-2-4-6-8-11(9)10-13/h1-8H2.
What are the key properties of 1-nitrosoazecan-2-one?
1-nitrosoazecan-2-one has a molecular weight of 184.24 g/mol, XLogP of 2.24, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-nitrosoazecan-2-one is sourced from PubChem (CID 14270809), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).