C30H35ClN6O4Si — CID 142709225
2-[[tert-butyl(dimethyl)silyl]oxymethyl]-N-[[5-[4-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]pyrimidin-5-yl]-1,2-oxazol-3-yl]methyl]prop-2-enamide (PubChem CID 142709225) has the molecular formula C30H35ClN6O4Si and a molecular weight of 607.19 g/mol. Its IUPAC name is 2-[[tert-butyl(dimethyl)silyl]oxymethyl]-N-[[5-[4-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]pyrimidin-5-yl]-1,2-oxazol-3-yl]methyl]prop-2-enamide.
| Compound Name | 2-[[tert-butyl(dimethyl)silyl]oxymethyl]-N-[[5-[4-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]pyrimidin-5-yl]-1,2-oxazol-3-yl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 142709225 |
| Molecular Formula | C30H35ClN6O4Si |
| Molecular Weight | 607.19 g/mol |
| Exact Mass | 606.22 |
| IUPAC Name | 2-[[tert-butyl(dimethyl)silyl]oxymethyl]-N-[[5-[4-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]pyrimidin-5-yl]-1,2-oxazol-3-yl]methyl]prop-2-enamide |
| SMILES | C=C(CO[Si](C)(C)C(C)(C)C)C(=O)NCc1cc(-c2cncnc2Nc2ccc(OCc3ccccn3)c(Cl)c2)on1 |
| InChI | InChI=1S/C30H35ClN6O4Si/c1-20(17-40-42(5,6)30(2,3)4)29(38)34-15-23-14-27(41-37-23)24-16-32-19-35-28(24)36-21-10-11-26(25(31)13-21)39-18-22-9-7-8-12-33-22/h7-14,16,19H,1,15,17-18H2,2-6H3,(H,34,38)(H,32,35,36) |
| InChIKey | SAPFILXGZLADQI-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 124.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.19 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|