About dimethyl 3,4-dimethylidenecyclohexane-1,1-dicarboxylate
dimethyl 3,4-dimethylidenecyclohexane-1,1-dicarboxylate (PubChem CID 14271077) has the molecular formula C12H16O4
and a molecular weight of 224.26 g/mol. Its IUPAC name is dimethyl 3,4-dimethylidenecyclohexane-1,1-dicarboxylate.
Molecular Properties
| Compound Name | dimethyl 3,4-dimethylidenecyclohexane-1,1-dicarboxylate |
| PubChem CID | 14271077 |
| Molecular Formula | C12H16O4 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.10 |
| IUPAC Name | dimethyl 3,4-dimethylidenecyclohexane-1,1-dicarboxylate |
| SMILES | C=C1CCC(C(=O)OC)(C(=O)OC)CC1=C |
| InChI | InChI=1S/C12H16O4/c1-8-5-6-12(7-9(8)2,10(13)15-3)11(14)16-4/h1-2,5-7H2,3-4H3 |
| InChIKey | MOUFAWLDUXYVRO-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze dimethyl 3,4-dimethylidenecyclohexane-1,1-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl 3,4-dimethylidenecyclohexane-1,1-dicarboxylate?
The IUPAC name of dimethyl 3,4-dimethylidenecyclohexane-1,1-dicarboxylate (CID 14271077) is dimethyl 3,4-dimethylidenecyclohexane-1,1-dicarboxylate.
What is the SMILES notation for dimethyl 3,4-dimethylidenecyclohexane-1,1-dicarboxylate?
The canonical SMILES for dimethyl 3,4-dimethylidenecyclohexane-1,1-dicarboxylate is C=C1CCC(C(=O)OC)(C(=O)OC)CC1=C.
What is the InChIKey of dimethyl 3,4-dimethylidenecyclohexane-1,1-dicarboxylate?
The InChIKey is MOUFAWLDUXYVRO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16O4/c1-8-5-6-12(7-9(8)2,10(13)15-3)11(14)16-4/h1-2,5-7H2,3-4H3.
What are the key properties of dimethyl 3,4-dimethylidenecyclohexane-1,1-dicarboxylate?
dimethyl 3,4-dimethylidenecyclohexane-1,1-dicarboxylate has a molecular weight of 224.26 g/mol, XLogP of 1.62, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl 3,4-dimethylidenecyclohexane-1,1-dicarboxylate is sourced from PubChem (CID 14271077), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).