C20H28BFN2O5 — CID 142710899
[(2S)-3-[2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1-oxo-1-pyrrolidin-1-ylpropan-2-yl]carbamic acid (PubChem CID 142710899) has the molecular formula C20H28BFN2O5 and a molecular weight of 406.26 g/mol. Its IUPAC name is [(2S)-3-[2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1-oxo-1-pyrrolidin-1-ylpropan-2-yl]carbamic acid.
| Compound Name | [(2S)-3-[2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1-oxo-1-pyrrolidin-1-ylpropan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 142710899 |
| Molecular Formula | C20H28BFN2O5 |
| Molecular Weight | 406.26 g/mol |
| Exact Mass | 406.21 |
| IUPAC Name | [(2S)-3-[2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1-oxo-1-pyrrolidin-1-ylpropan-2-yl]carbamic acid |
| SMILES | CC1(C)OB(c2ccc(C[C@H](NC(=O)O)C(=O)N3CCCC3)c(F)c2)OC1(C)C |
| InChI | InChI=1S/C20H28BFN2O5/c1-19(2)20(3,4)29-21(28-19)14-8-7-13(15(22)12-14)11-16(23-18(26)27)17(25)24-9-5-6-10-24/h7-8,12,16,23H,5-6,9-11H2,1-4H3,(H,26,27)/t16-/m0/s1 |
| InChIKey | MKRFWVDOVDKCOY-INIZCTEOSA-N |
| XLogP | 1.93 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.26 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|