C42H37BN2O2 — CID 142710965
N,N-diphenyl-3-(9-phenylcarbazol-3-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline (PubChem CID 142710965) has the molecular formula C42H37BN2O2 and a molecular weight of 612.58 g/mol. Its IUPAC name is N,N-diphenyl-3-(9-phenylcarbazol-3-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline.
| Compound Name | N,N-diphenyl-3-(9-phenylcarbazol-3-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline |
|---|---|
| PubChem CID | 142710965 |
| Molecular Formula | C42H37BN2O2 |
| Molecular Weight | 612.58 g/mol |
| Exact Mass | 612.29 |
| IUPAC Name | N,N-diphenyl-3-(9-phenylcarbazol-3-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline |
| SMILES | CC1(C)OB(c2cc(-c3ccc4c(c3)c3ccccc3n4-c3ccccc3)cc(N(c3ccccc3)c3ccccc3)c2)OC1(C)C |
| InChI | InChI=1S/C42H37BN2O2/c1-41(2)42(3,4)47-43(46-41)32-26-31(27-36(29-32)44(33-16-8-5-9-17-33)34-18-10-6-11-19-34)30-24-25-40-38(28-30)37-22-14-15-23-39(37)45(40)35-20-12-7-13-21-35/h5-29H,1-4H3 |
| InChIKey | PSTHXBCYBQGFQV-UHFFFAOYSA-N |
| XLogP | 10.22 |
| TPSA | 26.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.58 |
| LogP ≤ 5 | 10.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|