C13H18FN3O3 — CID 142711016
ethyl 3-[[2-fluoro-4-(N'-hydroxycarbamimidoyl)phenyl]methylamino]propanoate (PubChem CID 142711016) has the molecular formula C13H18FN3O3 and a molecular weight of 283.30 g/mol. Its IUPAC name is ethyl 3-[[2-fluoro-4-(N'-hydroxycarbamimidoyl)phenyl]methylamino]propanoate.
| Compound Name | ethyl 3-[[2-fluoro-4-(N'-hydroxycarbamimidoyl)phenyl]methylamino]propanoate |
|---|---|
| PubChem CID | 142711016 |
| Molecular Formula | C13H18FN3O3 |
| Molecular Weight | 283.30 g/mol |
| Exact Mass | 283.13 |
| IUPAC Name | ethyl 3-[[2-fluoro-4-(N'-hydroxycarbamimidoyl)phenyl]methylamino]propanoate |
| SMILES | CCOC(=O)CCNCc1ccc(C(N)=NO)cc1F |
| InChI | InChI=1S/C13H18FN3O3/c1-2-20-12(18)5-6-16-8-10-4-3-9(7-11(10)14)13(15)17-19/h3-4,7,16,19H,2,5-6,8H2,1H3,(H2,15,17) |
| InChIKey | ZUZUKDHQKPDUIH-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 96.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.30 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|