About 4-thiophen-2-yl-5H-oxathiazole 2,2-dioxide
4-thiophen-2-yl-5H-oxathiazole 2,2-dioxide (PubChem CID 142711088) has the molecular formula C6H5NO3S2
and a molecular weight of 203.24 g/mol. Its IUPAC name is 4-thiophen-2-yl-5H-oxathiazole 2,2-dioxide.
Molecular Properties
| Compound Name | 4-thiophen-2-yl-5H-oxathiazole 2,2-dioxide |
| PubChem CID | 142711088 |
| Molecular Formula | C6H5NO3S2 |
| Molecular Weight | 203.24 g/mol |
| Exact Mass | 202.97 |
| IUPAC Name | 4-thiophen-2-yl-5H-oxathiazole 2,2-dioxide |
| SMILES | O=S1(=O)N=C(c2cccs2)CO1 |
| InChI | InChI=1S/C6H5NO3S2/c8-12(9)7-5(4-10-12)6-2-1-3-11-6/h1-3H,4H2 |
| InChIKey | KUZWNYQERORDEK-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.24 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-thiophen-2-yl-5H-oxathiazole 2,2-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-thiophen-2-yl-5H-oxathiazole 2,2-dioxide?
The IUPAC name of 4-thiophen-2-yl-5H-oxathiazole 2,2-dioxide (CID 142711088) is 4-thiophen-2-yl-5H-oxathiazole 2,2-dioxide.
What is the SMILES notation for 4-thiophen-2-yl-5H-oxathiazole 2,2-dioxide?
The canonical SMILES for 4-thiophen-2-yl-5H-oxathiazole 2,2-dioxide is O=S1(=O)N=C(c2cccs2)CO1.
What is the InChIKey of 4-thiophen-2-yl-5H-oxathiazole 2,2-dioxide?
The InChIKey is KUZWNYQERORDEK-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5NO3S2/c8-12(9)7-5(4-10-12)6-2-1-3-11-6/h1-3H,4H2.
What are the key properties of 4-thiophen-2-yl-5H-oxathiazole 2,2-dioxide?
4-thiophen-2-yl-5H-oxathiazole 2,2-dioxide has a molecular weight of 203.24 g/mol, XLogP of 0.81, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-thiophen-2-yl-5H-oxathiazole 2,2-dioxide is sourced from PubChem (CID 142711088), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).