C25H34FN3O5 — CID 142711320
(2S)-2-[(2-aminoacetyl)amino]-N-[(2S)-1,1-dimethoxypropan-2-yl]-N-[2-(3-fluorophenyl)ethyl]-3-phenylmethoxypropanamide (PubChem CID 142711320) has the molecular formula C25H34FN3O5 and a molecular weight of 475.56 g/mol. Its IUPAC name is (2S)-2-[(2-aminoacetyl)amino]-N-[(2S)-1,1-dimethoxypropan-2-yl]-N-[2-(3-fluorophenyl)ethyl]-3-phenylmethoxypropanamide.
| Compound Name | (2S)-2-[(2-aminoacetyl)amino]-N-[(2S)-1,1-dimethoxypropan-2-yl]-N-[2-(3-fluorophenyl)ethyl]-3-phenylmethoxypropanamide |
|---|---|
| PubChem CID | 142711320 |
| Molecular Formula | C25H34FN3O5 |
| Molecular Weight | 475.56 g/mol |
| Exact Mass | 475.25 |
| IUPAC Name | (2S)-2-[(2-aminoacetyl)amino]-N-[(2S)-1,1-dimethoxypropan-2-yl]-N-[2-(3-fluorophenyl)ethyl]-3-phenylmethoxypropanamide |
| SMILES | COC(OC)[C@H](C)N(CCc1cccc(F)c1)C(=O)[C@H](COCc1ccccc1)NC(=O)CN |
| InChI | InChI=1S/C25H34FN3O5/c1-18(25(32-2)33-3)29(13-12-19-10-7-11-21(26)14-19)24(31)22(28-23(30)15-27)17-34-16-20-8-5-4-6-9-20/h4-11,14,18,22,25H,12-13,15-17,27H2,1-3H3,(H,28,30)/t18-,22-/m0/s1 |
| InChIKey | MXZAQXPJFWRKRL-AVRDEDQJSA-N |
| XLogP | 1.86 |
| TPSA | 103.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.56 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|