C9H19BO3 — CID 142712921
1-hydroxy-2-methoxy-4,4,5,5-tetramethylborolan-3-ol (PubChem CID 142712921) has the molecular formula C9H19BO3 and a molecular weight of 186.06 g/mol. Its IUPAC name is 1-hydroxy-2-methoxy-4,4,5,5-tetramethylborolan-3-ol.
| Compound Name | 1-hydroxy-2-methoxy-4,4,5,5-tetramethylborolan-3-ol |
|---|---|
| PubChem CID | 142712921 |
| Molecular Formula | C9H19BO3 |
| Molecular Weight | 186.06 g/mol |
| Exact Mass | 186.14 |
| IUPAC Name | 1-hydroxy-2-methoxy-4,4,5,5-tetramethylborolan-3-ol |
| SMILES | COC1B(O)C(C)(C)C(C)(C)C1O |
| InChI | InChI=1S/C9H19BO3/c1-8(2)6(11)7(13-5)10(12)9(8,3)4/h6-7,11-12H,1-5H3 |
| InChIKey | CFRQKZLVXPAXMA-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.06 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|